C14H18FN3O2 — CID 124972311
(2R)-1-acetyl-4-[(2-fluorophenyl)methyl]piperazine-2-carboxamide (PubChem CID 124972311) has the molecular formula C14H18FN3O2 and a molecular weight of 279.31 g/mol. Its IUPAC name is (2R)-1-acetyl-4-[(2-fluorophenyl)methyl]piperazine-2-carboxamide.
| Compound Name | (2R)-1-acetyl-4-[(2-fluorophenyl)methyl]piperazine-2-carboxamide |
|---|---|
| PubChem CID | 124972311 |
| Molecular Formula | C14H18FN3O2 |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | (2R)-1-acetyl-4-[(2-fluorophenyl)methyl]piperazine-2-carboxamide |
| SMILES | CC(=O)N1CCN(Cc2ccccc2F)C[C@@H]1C(N)=O |
| InChI | InChI=1S/C14H18FN3O2/c1-10(19)18-7-6-17(9-13(18)14(16)20)8-11-4-2-3-5-12(11)15/h2-5,13H,6-9H2,1H3,(H2,16,20)/t13-/m1/s1 |
| InChIKey | KCFSJOYEHVCFDF-CYBMUJFWSA-N |
| XLogP | 0.34 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |