About N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine
N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine (PubChem CID 124972535) has the molecular formula C16H28N4O
and a molecular weight of 292.43 g/mol. Its IUPAC name is N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine |
| PubChem CID | 124972535 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine |
| SMILES | CCN(CCN(C)C)Cc1cnc([C@H]2CCCCO2)nc1 |
| InChI | InChI=1S/C16H28N4O/c1-4-20(9-8-19(2)3)13-14-11-17-16(18-12-14)15-7-5-6-10-21-15/h11-12,15H,4-10,13H2,1-3H3/t15-/m1/s1 |
| InChIKey | KDSOIRGQFAFWRC-OAHLLOKOSA-N |
| XLogP | 2.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine?
The IUPAC name of N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine (CID 124972535) is N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine?
The canonical SMILES for N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine is CCN(CCN(C)C)Cc1cnc([C@H]2CCCCO2)nc1.
What is the InChIKey of N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine?
The InChIKey is KDSOIRGQFAFWRC-OAHLLOKOSA-N. The full InChI is InChI=1S/C16H28N4O/c1-4-20(9-8-19(2)3)13-14-11-17-16(18-12-14)15-7-5-6-10-21-15/h11-12,15H,4-10,13H2,1-3H3/t15-/m1/s1.
What are the key properties of N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine?
N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine has a molecular weight of 292.43 g/mol, XLogP of 2.10, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-ethyl-N,N-dimethyl-N'-[[2-[(2R)-oxan-2-yl]pyrimidin-5-yl]methyl]ethane-1,2-diamine is sourced from PubChem (CID 124972535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).