C27H29FN2O — CID 124974103
1-[(2R)-2-(5-benzyl-2-pyridinyl)pyrrolidin-1-yl]-4-(4-fluoro-3-methylphenyl)butan-1-one (PubChem CID 124974103) has the molecular formula C27H29FN2O and a molecular weight of 416.54 g/mol. Its IUPAC name is 1-[(2R)-2-(5-benzyl-2-pyridinyl)pyrrolidin-1-yl]-4-(4-fluoro-3-methylphenyl)butan-1-one.
| Compound Name | 1-[(2R)-2-(5-benzyl-2-pyridinyl)pyrrolidin-1-yl]-4-(4-fluoro-3-methylphenyl)butan-1-one |
|---|---|
| PubChem CID | 124974103 |
| Molecular Formula | C27H29FN2O |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-[(2R)-2-(5-benzyl-2-pyridinyl)pyrrolidin-1-yl]-4-(4-fluoro-3-methylphenyl)butan-1-one |
| SMILES | Cc1cc(CCCC(=O)N2CCC[C@@H]2c2ccc(Cc3ccccc3)cn2)ccc1F |
| InChI | InChI=1S/C27H29FN2O/c1-20-17-22(12-14-24(20)28)9-5-11-27(31)30-16-6-10-26(30)25-15-13-23(19-29-25)18-21-7-3-2-4-8-21/h2-4,7-8,12-15,17,19,26H,5-6,9-11,16,18H2,1H3/t26-/m1/s1 |
| InChIKey | KOIVKHGNMSHSTH-AREMUKBSSA-N |
| XLogP | 5.81 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |