C23H19NO3 — CID 124974677
(1S)-14-benzyl-15-methyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6,10,12(17),15-hexaen-13-one (PubChem CID 124974677) has the molecular formula C23H19NO3 and a molecular weight of 357.41 g/mol. Its IUPAC name is (1S)-14-benzyl-15-methyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6,10,12(17),15-hexaen-13-one.
| Compound Name | (1S)-14-benzyl-15-methyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6,10,12(17),15-hexaen-13-one |
|---|---|
| PubChem CID | 124974677 |
| Molecular Formula | C23H19NO3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | (1S)-14-benzyl-15-methyl-8,18-dioxa-14-azatetracyclo[8.8.0.02,7.012,17]octadeca-2,4,6,10,12(17),15-hexaen-13-one |
| SMILES | Cc1cc2c(c(=O)n1Cc1ccccc1)C=C1COc3ccccc3[C@H]1O2 |
| InChI | InChI=1S/C23H19NO3/c1-15-11-21-19(23(25)24(15)13-16-7-3-2-4-8-16)12-17-14-26-20-10-6-5-9-18(20)22(17)27-21/h2-12,22H,13-14H2,1H3/t22-/m0/s1 |
| InChIKey | KSJUKQUJHOXNBL-QFIPXVFZSA-N |
| XLogP | 4.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |