C16H24N4O2 — CID 124977606
(2S)-1-[3-(dimethylamino)benzoyl]-N,4-dimethylpiperazine-2-carboxamide (PubChem CID 124977606) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2S)-1-[3-(dimethylamino)benzoyl]-N,4-dimethylpiperazine-2-carboxamide.
| Compound Name | (2S)-1-[3-(dimethylamino)benzoyl]-N,4-dimethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 124977606 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (2S)-1-[3-(dimethylamino)benzoyl]-N,4-dimethylpiperazine-2-carboxamide |
| SMILES | CNC(=O)[C@@H]1CN(C)CCN1C(=O)c1cccc(N(C)C)c1 |
| InChI | InChI=1S/C16H24N4O2/c1-17-15(21)14-11-19(4)8-9-20(14)16(22)12-6-5-7-13(10-12)18(2)3/h5-7,10,14H,8-9,11H2,1-4H3,(H,17,21)/t14-/m0/s1 |
| InChIKey | LNQULSDBLUNXLW-AWEZNQCLSA-N |
| XLogP | 0.25 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |