C19H22N4O2 — CID 124978298
(2-cyclopropylpyrimidin-5-yl)-[(2R)-2-(4-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 124978298) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2-cyclopropylpyrimidin-5-yl)-[(2R)-2-(4-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | (2-cyclopropylpyrimidin-5-yl)-[(2R)-2-(4-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 124978298 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2-cyclopropylpyrimidin-5-yl)-[(2R)-2-(4-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc([C@@H]2CNCCN2C(=O)c2cnc(C3CC3)nc2)cc1 |
| InChI | InChI=1S/C19H22N4O2/c1-25-16-6-4-13(5-7-16)17-12-20-8-9-23(17)19(24)15-10-21-18(22-11-15)14-2-3-14/h4-7,10-11,14,17,20H,2-3,8-9,12H2,1H3/t17-/m0/s1 |
| InChIKey | LSWVMZYZMIEWIX-KRWDZBQOSA-N |
| XLogP | 2.15 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |