C22H31NO2 — CID 124979128
N-[(1S,5S,6S,8R,10S)-9,9-dimethyl-5-(4-methylphenyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide (PubChem CID 124979128) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is N-[(1S,5S,6S,8R,10S)-9,9-dimethyl-5-(4-methylphenyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide.
| Compound Name | N-[(1S,5S,6S,8R,10S)-9,9-dimethyl-5-(4-methylphenyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide |
|---|---|
| PubChem CID | 124979128 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | N-[(1S,5S,6S,8R,10S)-9,9-dimethyl-5-(4-methylphenyl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide |
| SMILES | CCC(=O)N[C@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](c4ccc(C)cc4)OCC[C@@]31C2 |
| InChI | InChI=1S/C22H31NO2/c1-5-18(24)23-20-21(3,4)16-12-17-19(15-8-6-14(2)7-9-15)25-11-10-22(17,20)13-16/h6-9,16-17,19-20H,5,10-13H2,1-4H3,(H,23,24)/t16-,17-,19-,20+,22-/m1/s1 |
| InChIKey | LYUVDQCZWYMZCL-AABFTTDASA-N |
| XLogP | 4.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |