About 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone
1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone (PubChem CID 124979282) has the molecular formula C14H25N3O5S
and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone |
| PubChem CID | 124979282 |
| Molecular Formula | C14H25N3O5S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone |
| SMILES | CC(=O)N1CCCN(C(=O)[C@@]2(C)CN(S(C)(=O)=O)CCO2)CC1 |
| InChI | InChI=1S/C14H25N3O5S/c1-12(18)15-5-4-6-16(8-7-15)13(19)14(2)11-17(9-10-22-14)23(3,20)21/h4-11H2,1-3H3/t14-/m1/s1 |
| InChIKey | MABJSTMMODZSPD-CQSZACIVSA-N |
| XLogP | -0.88 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone?
The IUPAC name of 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone (CID 124979282) is 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone.
What is the SMILES notation for 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone?
The canonical SMILES for 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone is CC(=O)N1CCCN(C(=O)[C@@]2(C)CN(S(C)(=O)=O)CCO2)CC1.
What is the InChIKey of 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone?
The InChIKey is MABJSTMMODZSPD-CQSZACIVSA-N. The full InChI is InChI=1S/C14H25N3O5S/c1-12(18)15-5-4-6-16(8-7-15)13(19)14(2)11-17(9-10-22-14)23(3,20)21/h4-11H2,1-3H3/t14-/m1/s1.
What are the key properties of 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone?
1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone has a molecular weight of 347.44 g/mol, XLogP of -0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(2R)-2-methyl-4-methylsulfonylmorpholine-2-carbonyl]-1,4-diazepan-1-yl]ethanone is sourced from PubChem (CID 124979282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).