C25H31N3O3 — CID 124979333
(2S)-4-[2-(4-methylphenoxy)ethyl]-2-[1-methyl-5-(2-phenoxyethyl)pyrazol-3-yl]morpholine (PubChem CID 124979333) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is (2S)-4-[2-(4-methylphenoxy)ethyl]-2-[1-methyl-5-(2-phenoxyethyl)pyrazol-3-yl]morpholine.
| Compound Name | (2S)-4-[2-(4-methylphenoxy)ethyl]-2-[1-methyl-5-(2-phenoxyethyl)pyrazol-3-yl]morpholine |
|---|---|
| PubChem CID | 124979333 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (2S)-4-[2-(4-methylphenoxy)ethyl]-2-[1-methyl-5-(2-phenoxyethyl)pyrazol-3-yl]morpholine |
| SMILES | Cc1ccc(OCCN2CCO[C@H](c3cc(CCOc4ccccc4)n(C)n3)C2)cc1 |
| InChI | InChI=1S/C25H31N3O3/c1-20-8-10-23(11-9-20)30-16-13-28-14-17-31-25(19-28)24-18-21(27(2)26-24)12-15-29-22-6-4-3-5-7-22/h3-11,18,25H,12-17,19H2,1-2H3/t25-/m0/s1 |
| InChIKey | MAOINRZSELPYFL-VWLOTQADSA-N |
| XLogP | 3.80 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |