C28H30N4O — CID 124979360
1-[(4S)-4-(imidazo[1,2-a]pyrazin-6-ylmethyl)azepan-1-yl]-2,2-diphenylpropan-1-one (PubChem CID 124979360) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is 1-[(4S)-4-(imidazo[1,2-a]pyrazin-6-ylmethyl)azepan-1-yl]-2,2-diphenylpropan-1-one.
| Compound Name | 1-[(4S)-4-(imidazo[1,2-a]pyrazin-6-ylmethyl)azepan-1-yl]-2,2-diphenylpropan-1-one |
|---|---|
| PubChem CID | 124979360 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | 1-[(4S)-4-(imidazo[1,2-a]pyrazin-6-ylmethyl)azepan-1-yl]-2,2-diphenylpropan-1-one |
| SMILES | CC(C(=O)N1CCC[C@H](Cc2cn3ccnc3cn2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H30N4O/c1-28(23-10-4-2-5-11-23,24-12-6-3-7-13-24)27(33)31-16-8-9-22(14-17-31)19-25-21-32-18-15-29-26(32)20-30-25/h2-7,10-13,15,18,20-22H,8-9,14,16-17,19H2,1H3/t22-/m0/s1 |
| InChIKey | MATIWTBPDNICSY-QFIPXVFZSA-N |
| XLogP | 4.91 |
| TPSA | 50.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |