C19H29NO3 — CID 124980177
(5R)-9-[(2-ethoxyphenyl)methyl]-5-methoxy-1-oxa-9-azaspiro[5.5]undecane (PubChem CID 124980177) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is (5R)-9-[(2-ethoxyphenyl)methyl]-5-methoxy-1-oxa-9-azaspiro[5.5]undecane.
| Compound Name | (5R)-9-[(2-ethoxyphenyl)methyl]-5-methoxy-1-oxa-9-azaspiro[5.5]undecane |
|---|---|
| PubChem CID | 124980177 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | (5R)-9-[(2-ethoxyphenyl)methyl]-5-methoxy-1-oxa-9-azaspiro[5.5]undecane |
| SMILES | CCOc1ccccc1CN1CCC2(CC1)OCCC[C@H]2OC |
| InChI | InChI=1S/C19H29NO3/c1-3-22-17-8-5-4-7-16(17)15-20-12-10-19(11-13-20)18(21-2)9-6-14-23-19/h4-5,7-8,18H,3,6,9-15H2,1-2H3/t18-/m1/s1 |
| InChIKey | MGUBIETZPCDYFH-GOSISDBHSA-N |
| XLogP | 3.25 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |