C27H30N2O2 — CID 124981222
(1-phenylcyclopentyl)-[(6R)-6-(quinolin-3-ylmethyl)-1,4-oxazepan-4-yl]methanone (PubChem CID 124981222) has the molecular formula C27H30N2O2 and a molecular weight of 414.55 g/mol. Its IUPAC name is (1-phenylcyclopentyl)-[(6R)-6-(quinolin-3-ylmethyl)-1,4-oxazepan-4-yl]methanone.
| Compound Name | (1-phenylcyclopentyl)-[(6R)-6-(quinolin-3-ylmethyl)-1,4-oxazepan-4-yl]methanone |
|---|---|
| PubChem CID | 124981222 |
| Molecular Formula | C27H30N2O2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | (1-phenylcyclopentyl)-[(6R)-6-(quinolin-3-ylmethyl)-1,4-oxazepan-4-yl]methanone |
| SMILES | O=C(N1CCOC[C@H](Cc2cnc3ccccc3c2)C1)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C27H30N2O2/c30-26(27(12-6-7-13-27)24-9-2-1-3-10-24)29-14-15-31-20-22(19-29)16-21-17-23-8-4-5-11-25(23)28-18-21/h1-5,8-11,17-18,22H,6-7,12-16,19-20H2/t22-/m1/s1 |
| InChIKey | MOQRGDZJWIPUJM-JOCHJYFZSA-N |
| XLogP | 4.76 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |