C18H21N7O — CID 124982957
2-(benzotriazol-2-yl)-1-[(2R)-2-[6-(dimethylamino)pyrazin-2-yl]pyrrolidin-1-yl]ethanone (PubChem CID 124982957) has the molecular formula C18H21N7O and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(benzotriazol-2-yl)-1-[(2R)-2-[6-(dimethylamino)pyrazin-2-yl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2-(benzotriazol-2-yl)-1-[(2R)-2-[6-(dimethylamino)pyrazin-2-yl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 124982957 |
| Molecular Formula | C18H21N7O |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 2-(benzotriazol-2-yl)-1-[(2R)-2-[6-(dimethylamino)pyrazin-2-yl]pyrrolidin-1-yl]ethanone |
| SMILES | CN(C)c1cncc([C@H]2CCCN2C(=O)Cn2nc3ccccc3n2)n1 |
| InChI | InChI=1S/C18H21N7O/c1-23(2)17-11-19-10-15(20-17)16-8-5-9-24(16)18(26)12-25-21-13-6-3-4-7-14(13)22-25/h3-4,6-7,10-11,16H,5,8-9,12H2,1-2H3/t16-/m1/s1 |
| InChIKey | NARMZWWANJOESL-MRXNPFEDSA-N |
| XLogP | 1.65 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |