C18H19N5O2 — CID 124983966
[(2S)-2-(4-amino-6-methyl-2-pyridinyl)morpholin-4-yl]-(1H-indazol-3-yl)methanone (PubChem CID 124983966) has the molecular formula C18H19N5O2 and a molecular weight of 337.38 g/mol. Its IUPAC name is [(2S)-2-(4-amino-6-methyl-2-pyridinyl)morpholin-4-yl]-(1H-indazol-3-yl)methanone.
| Compound Name | [(2S)-2-(4-amino-6-methyl-2-pyridinyl)morpholin-4-yl]-(1H-indazol-3-yl)methanone |
|---|---|
| PubChem CID | 124983966 |
| Molecular Formula | C18H19N5O2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | [(2S)-2-(4-amino-6-methyl-2-pyridinyl)morpholin-4-yl]-(1H-indazol-3-yl)methanone |
| SMILES | Cc1cc(N)cc([C@@H]2CN(C(=O)c3n[nH]c4ccccc34)CCO2)n1 |
| InChI | InChI=1S/C18H19N5O2/c1-11-8-12(19)9-15(20-11)16-10-23(6-7-25-16)18(24)17-13-4-2-3-5-14(13)21-22-17/h2-5,8-9,16H,6-7,10H2,1H3,(H2,19,20)(H,21,22)/t16-/m0/s1 |
| InChIKey | NHMMDZUYQAAYHV-INIZCTEOSA-N |
| XLogP | 2.06 |
| TPSA | 97.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |