C22H25N5 — CID 124984466
N-(2-ethylphenyl)-2-[(3R)-piperidin-3-yl]-6-pyridin-3-ylpyrimidin-4-amine (PubChem CID 124984466) has the molecular formula C22H25N5 and a molecular weight of 359.48 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[(3R)-piperidin-3-yl]-6-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | N-(2-ethylphenyl)-2-[(3R)-piperidin-3-yl]-6-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 124984466 |
| Molecular Formula | C22H25N5 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | N-(2-ethylphenyl)-2-[(3R)-piperidin-3-yl]-6-pyridin-3-ylpyrimidin-4-amine |
| SMILES | CCc1ccccc1Nc1cc(-c2cccnc2)nc([C@@H]2CCCNC2)n1 |
| InChI | InChI=1S/C22H25N5/c1-2-16-7-3-4-10-19(16)25-21-13-20(17-8-5-11-23-14-17)26-22(27-21)18-9-6-12-24-15-18/h3-5,7-8,10-11,13-14,18,24H,2,6,9,12,15H2,1H3,(H,25,26,27)/t18-/m1/s1 |
| InChIKey | NKYYBJLUNAGDTO-GOSISDBHSA-N |
| XLogP | 4.31 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |