About [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone
[(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone (PubChem CID 124987765) has the molecular formula C18H17N3O2S
and a molecular weight of 339.42 g/mol. Its IUPAC name is [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone.
Molecular Properties
| Compound Name | [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone |
| PubChem CID | 124987765 |
| Molecular Formula | C18H17N3O2S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone |
| SMILES | COc1cccc([C@@H]2Cn3ccnc3CN2C(=O)c2cccs2)c1 |
| InChI | InChI=1S/C18H17N3O2S/c1-23-14-5-2-4-13(10-14)15-11-20-8-7-19-17(20)12-21(15)18(22)16-6-3-9-24-16/h2-10,15H,11-12H2,1H3/t15-/m0/s1 |
| InChIKey | OIKIJVWHSFJWPK-HNNXBMFYSA-N |
| XLogP | 3.35 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone?
The IUPAC name of [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone (CID 124987765) is [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone.
What is the SMILES notation for [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone?
The canonical SMILES for [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone is COc1cccc([C@@H]2Cn3ccnc3CN2C(=O)c2cccs2)c1.
What is the InChIKey of [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone?
The InChIKey is OIKIJVWHSFJWPK-HNNXBMFYSA-N. The full InChI is InChI=1S/C18H17N3O2S/c1-23-14-5-2-4-13(10-14)15-11-20-8-7-19-17(20)12-21(15)18(22)16-6-3-9-24-16/h2-10,15H,11-12H2,1H3/t15-/m0/s1.
What are the key properties of [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone?
[(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone has a molecular weight of 339.42 g/mol, XLogP of 3.35, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(6R)-6-(3-methoxyphenyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-yl]-thiophen-2-ylmethanone is sourced from PubChem (CID 124987765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).