C15H18N6O — CID 124988875
[(3S)-3-[(3-aminopyrazin-2-yl)methyl]piperidin-1-yl]-pyrazin-2-ylmethanone (PubChem CID 124988875) has the molecular formula C15H18N6O and a molecular weight of 298.35 g/mol. Its IUPAC name is [(3S)-3-[(3-aminopyrazin-2-yl)methyl]piperidin-1-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(3S)-3-[(3-aminopyrazin-2-yl)methyl]piperidin-1-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 124988875 |
| Molecular Formula | C15H18N6O |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | [(3S)-3-[(3-aminopyrazin-2-yl)methyl]piperidin-1-yl]-pyrazin-2-ylmethanone |
| SMILES | Nc1nccnc1C[C@@H]1CCCN(C(=O)c2cnccn2)C1 |
| InChI | InChI=1S/C15H18N6O/c16-14-12(18-5-6-20-14)8-11-2-1-7-21(10-11)15(22)13-9-17-3-4-19-13/h3-6,9,11H,1-2,7-8,10H2,(H2,16,20)/t11-/m0/s1 |
| InChIKey | OQCQZLBNXPJDOD-NSHDSACASA-N |
| XLogP | 0.94 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |