C26H26FN3O3 — CID 124989278
(5-fluoro-3-methyl-1H-indol-2-yl)-[(3R)-3-[5-[(3-methoxyphenyl)methyl]-1,3-oxazol-2-yl]piperidin-1-yl]methanone (PubChem CID 124989278) has the molecular formula C26H26FN3O3 and a molecular weight of 447.51 g/mol. Its IUPAC name is (5-fluoro-3-methyl-1H-indol-2-yl)-[(3R)-3-[5-[(3-methoxyphenyl)methyl]-1,3-oxazol-2-yl]piperidin-1-yl]methanone.
| Compound Name | (5-fluoro-3-methyl-1H-indol-2-yl)-[(3R)-3-[5-[(3-methoxyphenyl)methyl]-1,3-oxazol-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124989278 |
| Molecular Formula | C26H26FN3O3 |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | (5-fluoro-3-methyl-1H-indol-2-yl)-[(3R)-3-[5-[(3-methoxyphenyl)methyl]-1,3-oxazol-2-yl]piperidin-1-yl]methanone |
| SMILES | COc1cccc(Cc2cnc([C@@H]3CCCN(C(=O)c4[nH]c5ccc(F)cc5c4C)C3)o2)c1 |
| InChI | InChI=1S/C26H26FN3O3/c1-16-22-13-19(27)8-9-23(22)29-24(16)26(31)30-10-4-6-18(15-30)25-28-14-21(33-25)12-17-5-3-7-20(11-17)32-2/h3,5,7-9,11,13-14,18,29H,4,6,10,12,15H2,1-2H3/t18-/m1/s1 |
| InChIKey | OTFRHQAGUALLBO-GOSISDBHSA-N |
| XLogP | 5.22 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|