C16H27N3O — CID 124989956
(3R)-3-(1,4-dimethylimidazol-2-yl)-1-(oxan-4-ylmethyl)piperidine (PubChem CID 124989956) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is (3R)-3-(1,4-dimethylimidazol-2-yl)-1-(oxan-4-ylmethyl)piperidine.
| Compound Name | (3R)-3-(1,4-dimethylimidazol-2-yl)-1-(oxan-4-ylmethyl)piperidine |
|---|---|
| PubChem CID | 124989956 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | (3R)-3-(1,4-dimethylimidazol-2-yl)-1-(oxan-4-ylmethyl)piperidine |
| SMILES | Cc1cn(C)c([C@@H]2CCCN(CC3CCOCC3)C2)n1 |
| InChI | InChI=1S/C16H27N3O/c1-13-10-18(2)16(17-13)15-4-3-7-19(12-15)11-14-5-8-20-9-6-14/h10,14-15H,3-9,11-12H2,1-2H3/t15-/m1/s1 |
| InChIKey | OYFCSSHXZGNDHJ-OAHLLOKOSA-N |
| XLogP | 2.33 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |