About 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone
1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone (PubChem CID 1249903) has the molecular formula C18H20N2O4
and a molecular weight of 328.37 g/mol. Its IUPAC name is 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone.
Molecular Properties
| Compound Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone |
| PubChem CID | 1249903 |
| Molecular Formula | C18H20N2O4 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3CCC4(CC3)OCCO4)no2)cc1 |
| InChI | InChI=1S/C18H20N2O4/c1-13-2-4-14(5-3-13)16-12-15(19-24-16)17(21)20-8-6-18(7-9-20)22-10-11-23-18/h2-5,12H,6-11H2,1H3 |
| InChIKey | DRKZBTCBPDNTGS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone?
The IUPAC name of 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone (CID 1249903) is 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone.
What is the SMILES notation for 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone?
The canonical SMILES for 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone is Cc1ccc(-c2cc(C(=O)N3CCC4(CC3)OCCO4)no2)cc1.
What is the InChIKey of 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone?
The InChIKey is DRKZBTCBPDNTGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O4/c1-13-2-4-14(5-3-13)16-12-15(19-24-16)17(21)20-8-6-18(7-9-20)22-10-11-23-18/h2-5,12H,6-11H2,1H3.
What are the key properties of 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone?
1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone has a molecular weight of 328.37 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxa-8-azaspiro[4.5]decan-8-yl-[5-(4-methylphenyl)-1,2-oxazol-3-yl]methanone is sourced from PubChem (CID 1249903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).