C18H36N4O4S — CID 124991806
N-[1-[[(4S)-1-(diethylsulfamoyl)-4-hydroxyazepan-4-yl]methyl]piperidin-4-yl]acetamide (PubChem CID 124991806) has the molecular formula C18H36N4O4S and a molecular weight of 404.58 g/mol. Its IUPAC name is N-[1-[[(4S)-1-(diethylsulfamoyl)-4-hydroxyazepan-4-yl]methyl]piperidin-4-yl]acetamide.
| Compound Name | N-[1-[[(4S)-1-(diethylsulfamoyl)-4-hydroxyazepan-4-yl]methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 124991806 |
| Molecular Formula | C18H36N4O4S |
| Molecular Weight | 404.58 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | N-[1-[[(4S)-1-(diethylsulfamoyl)-4-hydroxyazepan-4-yl]methyl]piperidin-4-yl]acetamide |
| SMILES | CCN(CC)S(=O)(=O)N1CCC[C@@](O)(CN2CCC(NC(C)=O)CC2)CC1 |
| InChI | InChI=1S/C18H36N4O4S/c1-4-21(5-2)27(25,26)22-11-6-9-18(24,10-14-22)15-20-12-7-17(8-13-20)19-16(3)23/h17,24H,4-15H2,1-3H3,(H,19,23)/t18-/m0/s1 |
| InChIKey | PLUWMYKRXOKKPW-SFHVURJKSA-N |
| XLogP | 0.39 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.58 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |