C22H27N5O — CID 124994832
[(1R)-cyclohex-3-en-1-yl]-[4-[6-[(6-methyl-2-pyridinyl)amino]pyrazin-2-yl]piperidin-1-yl]methanone (PubChem CID 124994832) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is [(1R)-cyclohex-3-en-1-yl]-[4-[6-[(6-methyl-2-pyridinyl)amino]pyrazin-2-yl]piperidin-1-yl]methanone.
| Compound Name | [(1R)-cyclohex-3-en-1-yl]-[4-[6-[(6-methyl-2-pyridinyl)amino]pyrazin-2-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 124994832 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | [(1R)-cyclohex-3-en-1-yl]-[4-[6-[(6-methyl-2-pyridinyl)amino]pyrazin-2-yl]piperidin-1-yl]methanone |
| SMILES | Cc1cccc(Nc2cncc(C3CCN(C(=O)[C@H]4CC=CCC4)CC3)n2)n1 |
| InChI | InChI=1S/C22H27N5O/c1-16-6-5-9-20(24-16)26-21-15-23-14-19(25-21)17-10-12-27(13-11-17)22(28)18-7-3-2-4-8-18/h2-3,5-6,9,14-15,17-18H,4,7-8,10-13H2,1H3,(H,24,25,26)/t18-/m0/s1 |
| InChIKey | QHMUGSBNDNNQDQ-SFHVURJKSA-N |
| XLogP | 3.99 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|