C19H24N2OS — CID 124996672
1-[(3S)-3-[(6-methyl-3-pyridinyl)methyl]piperidin-1-yl]-3-thiophen-2-ylpropan-1-one (PubChem CID 124996672) has the molecular formula C19H24N2OS and a molecular weight of 328.48 g/mol. Its IUPAC name is 1-[(3S)-3-[(6-methyl-3-pyridinyl)methyl]piperidin-1-yl]-3-thiophen-2-ylpropan-1-one.
| Compound Name | 1-[(3S)-3-[(6-methyl-3-pyridinyl)methyl]piperidin-1-yl]-3-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 124996672 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 1-[(3S)-3-[(6-methyl-3-pyridinyl)methyl]piperidin-1-yl]-3-thiophen-2-ylpropan-1-one |
| SMILES | Cc1ccc(C[C@@H]2CCCN(C(=O)CCc3cccs3)C2)cn1 |
| InChI | InChI=1S/C19H24N2OS/c1-15-6-7-16(13-20-15)12-17-4-2-10-21(14-17)19(22)9-8-18-5-3-11-23-18/h3,5-7,11,13,17H,2,4,8-10,12,14H2,1H3/t17-/m0/s1 |
| InChIKey | QUVXEUGOXKQGAM-KRWDZBQOSA-N |
| XLogP | 3.87 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |