C16H19N3O2S — CID 124997234
[(2R)-2-[6-(dimethylamino)-2-pyridinyl]morpholin-4-yl]-thiophen-2-ylmethanone (PubChem CID 124997234) has the molecular formula C16H19N3O2S and a molecular weight of 317.41 g/mol. Its IUPAC name is [(2R)-2-[6-(dimethylamino)-2-pyridinyl]morpholin-4-yl]-thiophen-2-ylmethanone.
| Compound Name | [(2R)-2-[6-(dimethylamino)-2-pyridinyl]morpholin-4-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 124997234 |
| Molecular Formula | C16H19N3O2S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | [(2R)-2-[6-(dimethylamino)-2-pyridinyl]morpholin-4-yl]-thiophen-2-ylmethanone |
| SMILES | CN(C)c1cccc([C@H]2CN(C(=O)c3cccs3)CCO2)n1 |
| InChI | InChI=1S/C16H19N3O2S/c1-18(2)15-7-3-5-12(17-15)13-11-19(8-9-21-13)16(20)14-6-4-10-22-14/h3-7,10,13H,8-9,11H2,1-2H3/t13-/m1/s1 |
| InChIKey | QYQONDRAEGDIPV-CYBMUJFWSA-N |
| XLogP | 2.42 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |