C16H28N2O5 — CID 124998464
[(2R)-4-[(4-hydroxyoxan-4-yl)methyl]-2-methylmorpholin-2-yl]-morpholin-4-ylmethanone (PubChem CID 124998464) has the molecular formula C16H28N2O5 and a molecular weight of 328.41 g/mol. Its IUPAC name is [(2R)-4-[(4-hydroxyoxan-4-yl)methyl]-2-methylmorpholin-2-yl]-morpholin-4-ylmethanone.
| Compound Name | [(2R)-4-[(4-hydroxyoxan-4-yl)methyl]-2-methylmorpholin-2-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 124998464 |
| Molecular Formula | C16H28N2O5 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | [(2R)-4-[(4-hydroxyoxan-4-yl)methyl]-2-methylmorpholin-2-yl]-morpholin-4-ylmethanone |
| SMILES | C[C@]1(C(=O)N2CCOCC2)CN(CC2(O)CCOCC2)CCO1 |
| InChI | InChI=1S/C16H28N2O5/c1-15(14(19)18-5-9-22-10-6-18)12-17(4-11-23-15)13-16(20)2-7-21-8-3-16/h20H,2-13H2,1H3/t15-/m1/s1 |
| InChIKey | RHWDGSXFPJDMNZ-OAHLLOKOSA-N |
| XLogP | -0.52 |
| TPSA | 71.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |