About 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone
1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone (PubChem CID 124999677) has the molecular formula C19H26N4O2
and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone |
| PubChem CID | 124999677 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc([C@@H]2CN(C(C)=O)CCN2Cc2cnn(C)c2C)cc1 |
| InChI | InChI=1S/C19H26N4O2/c1-14-17(11-20-21(14)3)12-23-10-9-22(15(2)24)13-19(23)16-5-7-18(25-4)8-6-16/h5-8,11,19H,9-10,12-13H2,1-4H3/t19-/m0/s1 |
| InChIKey | RQKDDDVGSPSSGW-IBGZPJMESA-N |
| XLogP | 2.14 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone?
The IUPAC name of 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone (CID 124999677) is 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone?
The canonical SMILES for 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone is COc1ccc([C@@H]2CN(C(C)=O)CCN2Cc2cnn(C)c2C)cc1.
What is the InChIKey of 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone?
The InChIKey is RQKDDDVGSPSSGW-IBGZPJMESA-N. The full InChI is InChI=1S/C19H26N4O2/c1-14-17(11-20-21(14)3)12-23-10-9-22(15(2)24)13-19(23)16-5-7-18(25-4)8-6-16/h5-8,11,19H,9-10,12-13H2,1-4H3/t19-/m0/s1.
What are the key properties of 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone?
1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone has a molecular weight of 342.44 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-4-[(1,5-dimethylpyrazol-4-yl)methyl]-3-(4-methoxyphenyl)piperazin-1-yl]ethanone is sourced from PubChem (CID 124999677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).