C20H25N3O3 — CID 125000995
[(2S)-2-[2-(2-amino-4-pyridinyl)ethyl]morpholin-4-yl]-[4-(methoxymethyl)phenyl]methanone (PubChem CID 125000995) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [(2S)-2-[2-(2-amino-4-pyridinyl)ethyl]morpholin-4-yl]-[4-(methoxymethyl)phenyl]methanone.
| Compound Name | [(2S)-2-[2-(2-amino-4-pyridinyl)ethyl]morpholin-4-yl]-[4-(methoxymethyl)phenyl]methanone |
|---|---|
| PubChem CID | 125000995 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [(2S)-2-[2-(2-amino-4-pyridinyl)ethyl]morpholin-4-yl]-[4-(methoxymethyl)phenyl]methanone |
| SMILES | COCc1ccc(C(=O)N2CCO[C@@H](CCc3ccnc(N)c3)C2)cc1 |
| InChI | InChI=1S/C20H25N3O3/c1-25-14-16-2-5-17(6-3-16)20(24)23-10-11-26-18(13-23)7-4-15-8-9-22-19(21)12-15/h2-3,5-6,8-9,12,18H,4,7,10-11,13-14H2,1H3,(H2,21,22)/t18-/m0/s1 |
| InChIKey | RZVABVPVBIRDAE-SFHVURJKSA-N |
| XLogP | 2.28 |
| TPSA | 77.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |