C22H20FN3O — CID 125002811
[(2S)-2-[6-(3-fluorophenyl)-3-pyridinyl]piperidin-1-yl]-pyridin-3-ylmethanone (PubChem CID 125002811) has the molecular formula C22H20FN3O and a molecular weight of 361.42 g/mol. Its IUPAC name is [(2S)-2-[6-(3-fluorophenyl)-3-pyridinyl]piperidin-1-yl]-pyridin-3-ylmethanone.
| Compound Name | [(2S)-2-[6-(3-fluorophenyl)-3-pyridinyl]piperidin-1-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 125002811 |
| Molecular Formula | C22H20FN3O |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | [(2S)-2-[6-(3-fluorophenyl)-3-pyridinyl]piperidin-1-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CCCC[C@H]1c1ccc(-c2cccc(F)c2)nc1 |
| InChI | InChI=1S/C22H20FN3O/c23-19-7-3-5-16(13-19)20-10-9-17(15-25-20)21-8-1-2-12-26(21)22(27)18-6-4-11-24-14-18/h3-7,9-11,13-15,21H,1-2,8,12H2/t21-/m0/s1 |
| InChIKey | SNCDSWUGGGMCAT-NRFANRHFSA-N |
| XLogP | 4.65 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |