C16H23N3O — CID 125002978
1-[[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]methyl]pyrrolidin-2-one (PubChem CID 125002978) has the molecular formula C16H23N3O and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-[[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]methyl]pyrrolidin-2-one.
| Compound Name | 1-[[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 125002978 |
| Molecular Formula | C16H23N3O |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | 1-[[(3S)-1-(pyridin-4-ylmethyl)piperidin-3-yl]methyl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C[C@H]1CCCN(Cc2ccncc2)C1 |
| InChI | InChI=1S/C16H23N3O/c20-16-4-2-10-19(16)13-15-3-1-9-18(12-15)11-14-5-7-17-8-6-14/h5-8,15H,1-4,9-13H2/t15-/m0/s1 |
| InChIKey | SOEJLQSNCTWCMZ-HNNXBMFYSA-N |
| XLogP | 1.92 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |