C24H35NO3 — CID 125005595
(1R,5S,6S,8R,10R)-5-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-ol (PubChem CID 125005595) has the molecular formula C24H35NO3 and a molecular weight of 385.55 g/mol. Its IUPAC name is (1R,5S,6S,8R,10R)-5-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-ol.
| Compound Name | (1R,5S,6S,8R,10R)-5-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-ol |
|---|---|
| PubChem CID | 125005595 |
| Molecular Formula | C24H35NO3 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | (1R,5S,6S,8R,10R)-5-[4-hydroxy-3-(piperidin-1-ylmethyl)phenyl]-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-ol |
| SMILES | CC1(C)[C@@H]2C[C@@H]3[C@@H](c4ccc(O)c(CN5CCCCC5)c4)OCC[C@@]3(C2)[C@@H]1O |
| InChI | InChI=1S/C24H35NO3/c1-23(2)18-13-19-21(28-11-8-24(19,14-18)22(23)27)16-6-7-20(26)17(12-16)15-25-9-4-3-5-10-25/h6-7,12,18-19,21-22,26-27H,3-5,8-11,13-15H2,1-2H3/t18-,19-,21-,22-,24+/m1/s1 |
| InChIKey | UAJZCKLEQYPGJT-JQILPUHPSA-N |
| XLogP | 4.25 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|