C18H22N4O2 — CID 125006022
(2-ethoxy-3-pyridinyl)-[(3R)-3-(2-methylpyrimidin-4-yl)piperidin-1-yl]methanone (PubChem CID 125006022) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is (2-ethoxy-3-pyridinyl)-[(3R)-3-(2-methylpyrimidin-4-yl)piperidin-1-yl]methanone.
| Compound Name | (2-ethoxy-3-pyridinyl)-[(3R)-3-(2-methylpyrimidin-4-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 125006022 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (2-ethoxy-3-pyridinyl)-[(3R)-3-(2-methylpyrimidin-4-yl)piperidin-1-yl]methanone |
| SMILES | CCOc1ncccc1C(=O)N1CCC[C@@H](c2ccnc(C)n2)C1 |
| InChI | InChI=1S/C18H22N4O2/c1-3-24-17-15(7-4-9-20-17)18(23)22-11-5-6-14(12-22)16-8-10-19-13(2)21-16/h4,7-10,14H,3,5-6,11-12H2,1-2H3/t14-/m1/s1 |
| InChIKey | UDEJYRIBERLELZ-CQSZACIVSA-N |
| XLogP | 2.60 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |