About 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide
5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide (PubChem CID 12500633) has the molecular formula C10H20N2OS
and a molecular weight of 216.35 g/mol. Its IUPAC name is 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide.
Molecular Properties
| Compound Name | 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide |
| PubChem CID | 12500633 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide |
| SMILES | CC(CC(=O)N(C)C)CC(=S)N(C)C |
| InChI | InChI=1S/C10H20N2OS/c1-8(6-9(13)11(2)3)7-10(14)12(4)5/h8H,6-7H2,1-5H3 |
| InChIKey | WRESSYGFBLMGGU-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide?
The IUPAC name of 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide (CID 12500633) is 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide.
What is the SMILES notation for 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide?
The canonical SMILES for 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide is CC(CC(=O)N(C)C)CC(=S)N(C)C.
What is the InChIKey of 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide?
The InChIKey is WRESSYGFBLMGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2OS/c1-8(6-9(13)11(2)3)7-10(14)12(4)5/h8H,6-7H2,1-5H3.
What are the key properties of 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide?
5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide has a molecular weight of 216.35 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(dimethylamino)-N,N,3-trimethyl-5-sulfanylidenepentanamide is sourced from PubChem (CID 12500633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).