C11H21NOS — CID 12500644
N,N,3,6-tetramethyl-5-oxoheptanethioamide (PubChem CID 12500644) has the molecular formula C11H21NOS and a molecular weight of 215.36 g/mol. Its IUPAC name is N,N,3,6-tetramethyl-5-oxoheptanethioamide.
| Compound Name | N,N,3,6-tetramethyl-5-oxoheptanethioamide |
|---|---|
| PubChem CID | 12500644 |
| Molecular Formula | C11H21NOS |
| Molecular Weight | 215.36 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N,N,3,6-tetramethyl-5-oxoheptanethioamide |
| SMILES | CC(CC(=O)C(C)C)CC(=S)N(C)C |
| InChI | InChI=1S/C11H21NOS/c1-8(2)10(13)6-9(3)7-11(14)12(4)5/h8-9H,6-7H2,1-5H3 |
| InChIKey | QVAWDJUWFHTLON-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|