C25H30FN7O — CID 125006692
1-[(2R)-2-[2-(dimethylamino)-5-(4-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one (PubChem CID 125006692) has the molecular formula C25H30FN7O and a molecular weight of 463.56 g/mol. Its IUPAC name is 1-[(2R)-2-[2-(dimethylamino)-5-(4-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one.
| Compound Name | 1-[(2R)-2-[2-(dimethylamino)-5-(4-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
|---|---|
| PubChem CID | 125006692 |
| Molecular Formula | C25H30FN7O |
| Molecular Weight | 463.56 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | 1-[(2R)-2-[2-(dimethylamino)-5-(4-fluorophenyl)pyrimidin-4-yl]piperidin-1-yl]-4-(pyrimidin-2-ylamino)butan-1-one |
| SMILES | CN(C)c1ncc(-c2ccc(F)cc2)c([C@H]2CCCCN2C(=O)CCCNc2ncccn2)n1 |
| InChI | InChI=1S/C25H30FN7O/c1-32(2)25-30-17-20(18-9-11-19(26)12-10-18)23(31-25)21-7-3-4-16-33(21)22(34)8-5-13-27-24-28-14-6-15-29-24/h6,9-12,14-15,17,21H,3-5,7-8,13,16H2,1-2H3,(H,27,28,29)/t21-/m1/s1 |
| InChIKey | UICCQKBGQSTGBG-OAQYLSRUSA-N |
| XLogP | 4.08 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|