C14H19N5 — CID 125006832
2-methyl-6-[(2S)-1-[(5-methyl-1H-imidazol-4-yl)methyl]pyrrolidin-2-yl]pyrazine (PubChem CID 125006832) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 2-methyl-6-[(2S)-1-[(5-methyl-1H-imidazol-4-yl)methyl]pyrrolidin-2-yl]pyrazine.
| Compound Name | 2-methyl-6-[(2S)-1-[(5-methyl-1H-imidazol-4-yl)methyl]pyrrolidin-2-yl]pyrazine |
|---|---|
| PubChem CID | 125006832 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 2-methyl-6-[(2S)-1-[(5-methyl-1H-imidazol-4-yl)methyl]pyrrolidin-2-yl]pyrazine |
| SMILES | Cc1cncc([C@@H]2CCCN2Cc2nc[nH]c2C)n1 |
| InChI | InChI=1S/C14H19N5/c1-10-6-15-7-12(18-10)14-4-3-5-19(14)8-13-11(2)16-9-17-13/h6-7,9,14H,3-5,8H2,1-2H3,(H,16,17)/t14-/m0/s1 |
| InChIKey | UJAPVLDPFMITPC-AWEZNQCLSA-N |
| XLogP | 2.15 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |