C20H25N3O2 — CID 125007571
2-[5-[[(3R)-1-propan-2-ylpiperidin-3-yl]methyl]pyrazin-2-yl]benzoic acid (PubChem CID 125007571) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is 2-[5-[[(3R)-1-propan-2-ylpiperidin-3-yl]methyl]pyrazin-2-yl]benzoic acid.
| Compound Name | 2-[5-[[(3R)-1-propan-2-ylpiperidin-3-yl]methyl]pyrazin-2-yl]benzoic acid |
|---|---|
| PubChem CID | 125007571 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | 2-[5-[[(3R)-1-propan-2-ylpiperidin-3-yl]methyl]pyrazin-2-yl]benzoic acid |
| SMILES | CC(C)N1CCC[C@H](Cc2cnc(-c3ccccc3C(=O)O)cn2)C1 |
| InChI | InChI=1S/C20H25N3O2/c1-14(2)23-9-5-6-15(13-23)10-16-11-22-19(12-21-16)17-7-3-4-8-18(17)20(24)25/h3-4,7-8,11-12,14-15H,5-6,9-10,13H2,1-2H3,(H,24,25)/t15-/m1/s1 |
| InChIKey | UOMRGSSZAPRFLT-OAHLLOKOSA-N |
| XLogP | 3.50 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |