C24H33N3O3 — CID 125013307
N-[(1S,5S,6S,8R,10S)-9,9-dimethyl-5-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide (PubChem CID 125013307) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[(1S,5S,6S,8R,10S)-9,9-dimethyl-5-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide.
| Compound Name | N-[(1S,5S,6S,8R,10S)-9,9-dimethyl-5-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
|---|---|
| PubChem CID | 125013307 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N-[(1S,5S,6S,8R,10S)-9,9-dimethyl-5-(1,3,6-trimethyl-2-oxobenzimidazol-5-yl)-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
| SMILES | CC(=O)N[C@H]1C(C)(C)[C@@H]2C[C@@H]3[C@@H](c4cc5c(cc4C)n(C)c(=O)n5C)OCC[C@@]31C2 |
| InChI | InChI=1S/C24H33N3O3/c1-13-9-18-19(27(6)22(29)26(18)5)11-16(13)20-17-10-15-12-24(17,7-8-30-20)21(23(15,3)4)25-14(2)28/h9,11,15,17,20-21H,7-8,10,12H2,1-6H3,(H,25,28)/t15-,17-,20-,21+,24-/m1/s1 |
| InChIKey | WEISJIKKEKUHQV-KCYCFVLESA-N |
| XLogP | 3.20 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |