C18H20Cl4FeN3S2 — CID 12501354
4-[1-chloro-5-[4-(dimethylamino)phenyl]-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-yl]-N,N-dimethylaniline;trichloroiron (PubChem CID 12501354) has the molecular formula C18H20Cl4FeN3S2 and a molecular weight of 540.17 g/mol. Its IUPAC name is 4-[1-chloro-5-[4-(dimethylamino)phenyl]-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-yl]-N,N-dimethylaniline;trichloroiron.
| Compound Name | 4-[1-chloro-5-[4-(dimethylamino)phenyl]-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-yl]-N,N-dimethylaniline;trichloroiron |
|---|---|
| PubChem CID | 12501354 |
| Molecular Formula | C18H20Cl4FeN3S2 |
| Molecular Weight | 540.17 g/mol |
| Exact Mass | 537.92 |
| IUPAC Name | 4-[1-chloro-5-[4-(dimethylamino)phenyl]-1λ4,2-dithia-4-azacyclopenta-3,5-dien-3-yl]-N,N-dimethylaniline;trichloroiron |
| SMILES | CN(C)c1ccc(C2=NC(c3ccc(N(C)C)cc3)=S(Cl)S2)cc1.Cl[Fe](Cl)Cl |
| InChI | InChI=1S/C18H20ClN3S2.3ClH.Fe/c1-21(2)15-9-5-13(6-10-15)17-20-18(24(19)23-17)14-7-11-16(12-8-14)22(3)4;;;;/h5-12H,1-4H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | DUYQCHSEKYNZOU-UHFFFAOYSA-K |
| XLogP | 6.89 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.17 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|