C23H25ClN2O3 — CID 125015862
(6R)-4-benzyl-10-(4-chlorobenzoyl)-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one (PubChem CID 125015862) has the molecular formula C23H25ClN2O3 and a molecular weight of 412.92 g/mol. Its IUPAC name is (6R)-4-benzyl-10-(4-chlorobenzoyl)-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one.
| Compound Name | (6R)-4-benzyl-10-(4-chlorobenzoyl)-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one |
|---|---|
| PubChem CID | 125015862 |
| Molecular Formula | C23H25ClN2O3 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (6R)-4-benzyl-10-(4-chlorobenzoyl)-1-oxa-4,10-diazaspiro[5.6]dodecan-3-one |
| SMILES | O=C1CO[C@@]2(CCCN(C(=O)c3ccc(Cl)cc3)CC2)CN1Cc1ccccc1 |
| InChI | InChI=1S/C23H25ClN2O3/c24-20-9-7-19(8-10-20)22(28)25-13-4-11-23(12-14-25)17-26(21(27)16-29-23)15-18-5-2-1-3-6-18/h1-3,5-10H,4,11-17H2/t23-/m1/s1 |
| InChIKey | WWQNFKIUFNYLMT-HSZRJFAPSA-N |
| XLogP | 3.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |