C17H19FN4O2 — CID 125016140
5-[(3S)-1-[2-(4-fluorophenyl)acetyl]pyrrolidin-3-yl]-N-methyl-1H-pyrazole-3-carboxamide (PubChem CID 125016140) has the molecular formula C17H19FN4O2 and a molecular weight of 330.36 g/mol. Its IUPAC name is 5-[(3S)-1-[2-(4-fluorophenyl)acetyl]pyrrolidin-3-yl]-N-methyl-1H-pyrazole-3-carboxamide.
| Compound Name | 5-[(3S)-1-[2-(4-fluorophenyl)acetyl]pyrrolidin-3-yl]-N-methyl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 125016140 |
| Molecular Formula | C17H19FN4O2 |
| Molecular Weight | 330.36 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 5-[(3S)-1-[2-(4-fluorophenyl)acetyl]pyrrolidin-3-yl]-N-methyl-1H-pyrazole-3-carboxamide |
| SMILES | CNC(=O)c1cc([C@H]2CCN(C(=O)Cc3ccc(F)cc3)C2)[nH]n1 |
| InChI | InChI=1S/C17H19FN4O2/c1-19-17(24)15-9-14(20-21-15)12-6-7-22(10-12)16(23)8-11-2-4-13(18)5-3-11/h2-5,9,12H,6-8,10H2,1H3,(H,19,24)(H,20,21)/t12-/m0/s1 |
| InChIKey | WYNMCAHASXKGQY-LBPRGKRZSA-N |
| XLogP | 1.47 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.36 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |