C16H23N5 — CID 125016297
4-[(2R)-1-[(1-propylpyrazol-4-yl)methyl]piperidin-2-yl]pyrimidine (PubChem CID 125016297) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-[(2R)-1-[(1-propylpyrazol-4-yl)methyl]piperidin-2-yl]pyrimidine.
| Compound Name | 4-[(2R)-1-[(1-propylpyrazol-4-yl)methyl]piperidin-2-yl]pyrimidine |
|---|---|
| PubChem CID | 125016297 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 4-[(2R)-1-[(1-propylpyrazol-4-yl)methyl]piperidin-2-yl]pyrimidine |
| SMILES | CCCn1cc(CN2CCCC[C@@H]2c2ccncn2)cn1 |
| InChI | InChI=1S/C16H23N5/c1-2-8-21-12-14(10-19-21)11-20-9-4-3-5-16(20)15-6-7-17-13-18-15/h6-7,10,12-13,16H,2-5,8-9,11H2,1H3/t16-/m1/s1 |
| InChIKey | WZLSOERVFPCVBI-MRXNPFEDSA-N |
| XLogP | 2.81 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |