C25H37NO5 — CID 125016414
3-hydroxy-N-[(1S,5S,6S,8R,10S)-5-(3-methoxy-4-propan-2-yloxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide (PubChem CID 125016414) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is 3-hydroxy-N-[(1S,5S,6S,8R,10S)-5-(3-methoxy-4-propan-2-yloxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide.
| Compound Name | 3-hydroxy-N-[(1S,5S,6S,8R,10S)-5-(3-methoxy-4-propan-2-yloxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide |
|---|---|
| PubChem CID | 125016414 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | 3-hydroxy-N-[(1S,5S,6S,8R,10S)-5-(3-methoxy-4-propan-2-yloxyphenyl)-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]propanamide |
| SMILES | COc1cc([C@H]2OCC[C@@]34C[C@@H](C[C@H]23)C(C)(C)[C@@H]4NC(=O)CCO)ccc1OC(C)C |
| InChI | InChI=1S/C25H37NO5/c1-15(2)31-19-7-6-16(12-20(19)29-5)22-18-13-17-14-25(18,9-11-30-22)23(24(17,3)4)26-21(28)8-10-27/h6-7,12,15,17-18,22-23,27H,8-11,13-14H2,1-5H3,(H,26,28)/t17-,18-,22-,23+,25-/m1/s1 |
| InChIKey | XAKIUIGANQCEQB-FYFGABSMSA-N |
| XLogP | 3.86 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |