About 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene
1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene (PubChem CID 12501714) has the molecular formula C21H17BrO2S
and a molecular weight of 413.34 g/mol. Its IUPAC name is 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene.
Molecular Properties
| Compound Name | 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene |
| PubChem CID | 12501714 |
| Molecular Formula | C21H17BrO2S |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)/C(=C(\Br)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H17BrO2S/c1-16-12-14-19(15-13-16)25(23,24)21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17/h2-15H,1H3/b21-20- |
| InChIKey | CPAXNXCTPKOPTH-MRCUWXFGSA-N |
| XLogP | 5.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene?
The IUPAC name of 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene (CID 12501714) is 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene.
What is the SMILES notation for 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene?
The canonical SMILES for 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene is Cc1ccc(S(=O)(=O)/C(=C(\Br)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene?
The InChIKey is CPAXNXCTPKOPTH-MRCUWXFGSA-N. The full InChI is InChI=1S/C21H17BrO2S/c1-16-12-14-19(15-13-16)25(23,24)21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17/h2-15H,1H3/b21-20-.
What are the key properties of 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene?
1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene has a molecular weight of 413.34 g/mol, XLogP of 5.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-2-bromo-1,2-diphenylethenyl]sulfonyl-4-methylbenzene is sourced from PubChem (CID 12501714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).