C15H23N5O3 — CID 125017904
N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpyrrolidin-3-yl]methyl]-2-morpholin-4-ylacetamide (PubChem CID 125017904) has the molecular formula C15H23N5O3 and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpyrrolidin-3-yl]methyl]-2-morpholin-4-ylacetamide.
| Compound Name | N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpyrrolidin-3-yl]methyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 125017904 |
| Molecular Formula | C15H23N5O3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.18 |
| IUPAC Name | N-[[(3R)-3-hydroxy-1-pyrazin-2-ylpyrrolidin-3-yl]methyl]-2-morpholin-4-ylacetamide |
| SMILES | O=C(CN1CCOCC1)NC[C@]1(O)CCN(c2cnccn2)C1 |
| InChI | InChI=1S/C15H23N5O3/c21-14(10-19-5-7-23-8-6-19)18-11-15(22)1-4-20(12-15)13-9-16-2-3-17-13/h2-3,9,22H,1,4-8,10-12H2,(H,18,21)/t15-/m1/s1 |
| InChIKey | XKRVARKNIMYQLD-OAHLLOKOSA-N |
| XLogP | -1.13 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |