C5H7F6OP — CID 12501807
1,1,1,3,3,3-hexafluoropropan-2-yloxy(dimethyl)phosphane (PubChem CID 12501807) has the molecular formula C5H7F6OP and a molecular weight of 228.07 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yloxy(dimethyl)phosphane.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yloxy(dimethyl)phosphane |
|---|---|
| PubChem CID | 12501807 |
| Molecular Formula | C5H7F6OP |
| Molecular Weight | 228.07 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yloxy(dimethyl)phosphane |
| SMILES | CP(C)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C5H7F6OP/c1-13(2)12-3(4(6,7)8)5(9,10)11/h3H,1-2H3 |
| InChIKey | PMSPGGUJIRFBBH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.07 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|