C14H20O2S — CID 12501845
S-tert-butyl (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanethioate (PubChem CID 12501845) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is S-tert-butyl (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanethioate.
| Compound Name | S-tert-butyl (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanethioate |
|---|---|
| PubChem CID | 12501845 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | S-tert-butyl (2S,3S)-3-hydroxy-2-methyl-3-phenylpropanethioate |
| SMILES | C[C@H](C(=O)SC(C)(C)C)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C14H20O2S/c1-10(13(16)17-14(2,3)4)12(15)11-8-6-5-7-9-11/h5-10,12,15H,1-4H3/t10-,12-/m0/s1 |
| InChIKey | LBHDIVBTIRAPJX-JQWIXIFHSA-N |
| XLogP | 3.41 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|