About 4-methyl-1,3-dihydrobenzimidazol-2-one
4-methyl-1,3-dihydrobenzimidazol-2-one (PubChem CID 12501974) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 4-methyl-1,3-dihydrobenzimidazol-2-one.
Molecular Properties
| Compound Name | 4-methyl-1,3-dihydrobenzimidazol-2-one |
| PubChem CID | 12501974 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 4-methyl-1,3-dihydrobenzimidazol-2-one |
| SMILES | Cc1cccc2[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C8H8N2O/c1-5-3-2-4-6-7(5)10-8(11)9-6/h2-4H,1H3,(H2,9,10,11) |
| InChIKey | HCHIWZADTVYYAR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-methyl-1,3-dihydrobenzimidazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-dihydrobenzimidazol-2-one?
The IUPAC name of 4-methyl-1,3-dihydrobenzimidazol-2-one (CID 12501974) is 4-methyl-1,3-dihydrobenzimidazol-2-one.
What is the SMILES notation for 4-methyl-1,3-dihydrobenzimidazol-2-one?
The canonical SMILES for 4-methyl-1,3-dihydrobenzimidazol-2-one is Cc1cccc2[nH]c(=O)[nH]c12.
What is the InChIKey of 4-methyl-1,3-dihydrobenzimidazol-2-one?
The InChIKey is HCHIWZADTVYYAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c1-5-3-2-4-6-7(5)10-8(11)9-6/h2-4H,1H3,(H2,9,10,11).
What are the key properties of 4-methyl-1,3-dihydrobenzimidazol-2-one?
4-methyl-1,3-dihydrobenzimidazol-2-one has a molecular weight of 148.16 g/mol, XLogP of 1.16, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-dihydrobenzimidazol-2-one is sourced from PubChem (CID 12501974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).