C16H17N3O2S — CID 125020144
1-[(2R)-2-phenyl-4-(1,3-thiazole-5-carbonyl)piperazin-1-yl]ethanone (PubChem CID 125020144) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-[(2R)-2-phenyl-4-(1,3-thiazole-5-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[(2R)-2-phenyl-4-(1,3-thiazole-5-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 125020144 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 1-[(2R)-2-phenyl-4-(1,3-thiazole-5-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)c2cncs2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H17N3O2S/c1-12(20)19-8-7-18(16(21)15-9-17-11-22-15)10-14(19)13-5-3-2-4-6-13/h2-6,9,11,14H,7-8,10H2,1H3/t14-/m0/s1 |
| InChIKey | YAXRPQLAXQURGH-AWEZNQCLSA-N |
| XLogP | 2.19 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |