About 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine
6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine (PubChem CID 125020940) has the molecular formula C15H17N7
and a molecular weight of 295.35 g/mol. Its IUPAC name is 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine |
| PubChem CID | 125020940 |
| Molecular Formula | C15H17N7 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine |
| SMILES | Nc1[nH]nc2nc([C@@H]3CCCN(c4ncccn4)C3)ccc12 |
| InChI | InChI=1S/C15H17N7/c16-13-11-4-5-12(19-14(11)21-20-13)10-3-1-8-22(9-10)15-17-6-2-7-18-15/h2,4-7,10H,1,3,8-9H2,(H3,16,19,20,21)/t10-/m1/s1 |
| InChIKey | YGIIIRFPBZKORD-SNVBAGLBSA-N |
| XLogP | 1.71 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine?
The IUPAC name of 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine (CID 125020940) is 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine.
What is the SMILES notation for 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine?
The canonical SMILES for 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine is Nc1[nH]nc2nc([C@@H]3CCCN(c4ncccn4)C3)ccc12.
What is the InChIKey of 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine?
The InChIKey is YGIIIRFPBZKORD-SNVBAGLBSA-N. The full InChI is InChI=1S/C15H17N7/c16-13-11-4-5-12(19-14(11)21-20-13)10-3-1-8-22(9-10)15-17-6-2-7-18-15/h2,4-7,10H,1,3,8-9H2,(H3,16,19,20,21)/t10-/m1/s1.
What are the key properties of 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine?
6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine has a molecular weight of 295.35 g/mol, XLogP of 1.71, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(3R)-1-pyrimidin-2-ylpiperidin-3-yl]-2H-pyrazolo[3,4-b]pyridin-3-amine is sourced from PubChem (CID 125020940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).