C24H30N2O3 — CID 125022134
6-[(2R)-1-(3-methylbutanoyl)pyrrolidin-2-yl]-2-(3-phenylpropyl)pyridine-3-carboxylic acid (PubChem CID 125022134) has the molecular formula C24H30N2O3 and a molecular weight of 394.52 g/mol. Its IUPAC name is 6-[(2R)-1-(3-methylbutanoyl)pyrrolidin-2-yl]-2-(3-phenylpropyl)pyridine-3-carboxylic acid.
| Compound Name | 6-[(2R)-1-(3-methylbutanoyl)pyrrolidin-2-yl]-2-(3-phenylpropyl)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 125022134 |
| Molecular Formula | C24H30N2O3 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.23 |
| IUPAC Name | 6-[(2R)-1-(3-methylbutanoyl)pyrrolidin-2-yl]-2-(3-phenylpropyl)pyridine-3-carboxylic acid |
| SMILES | CC(C)CC(=O)N1CCC[C@@H]1c1ccc(C(=O)O)c(CCCc2ccccc2)n1 |
| InChI | InChI=1S/C24H30N2O3/c1-17(2)16-23(27)26-15-7-12-22(26)21-14-13-19(24(28)29)20(25-21)11-6-10-18-8-4-3-5-9-18/h3-5,8-9,13-14,17,22H,6-7,10-12,15-16H2,1-2H3,(H,28,29)/t22-/m1/s1 |
| InChIKey | YOMIKJQYLTZTRM-JOCHJYFZSA-N |
| XLogP | 4.66 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |